| Identification | |
| Name: | 2,3-Dibromopropanol |
| Synonyms: | 2,3-dibromo-1-propanol; allyl alcohol dibromide; beta-dibromohydrin; dibromopropanol; glycerol 1,2-dibromohydrin |
| CAS: | 96-13-9 |
| EINECS: | 202-480-9 |
| Molecular Formula: | C3H6Br2O |
| Molecular Weight: | 217.89 |
| InChI: | InChI=1/C3H6Br2O/c4-1-3(5)2-6/h3,6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | 8 |
| Density: | 2.12 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.559(lit.) |
| Solubility: | 5-10 g/100 mL at 20 ºC |
| Appearance: | Clear colorless to slightly yellow viscous liquid. |
| Specification: |
2,3-Dibromopropanol (96-13-9) is a clear colorless to slightly yellow viscous liquid. It is soluble in alcohol, ether, benzene, acetone and acetic acid, slightly soluble in water. It is probably combustible and incompatible with strong oxidizers. |
| Report: |
NTP 10th Report on Carcinogens. Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | COLORLESS LIQUID |
| Usage: | Intermediate in the preparation of flame retardants, insecticides, and pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
