| Identification |
| Name: | 3-Pentanone |
| Synonyms: | Diethyl ketone; (C2H5)2CO; 1,3-Dimethylacetone; 3-Oxopentane; 3-Pentanon; DEK; Diathylketon; Diethylcetone; diethylcetone(french) |
| CAS: | 96-22-0 |
| EINECS: | 202-490-3 |
| Molecular Formula: | C5H10O |
| Molecular Weight: | 86.13 |
| InChI: | InChI=1/C5H10O/c1-3-5(6)4-2/h3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1156 |
| Density: | 0.815 |
| Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. Incompatible with strong bases, reducing agents, strong oxidizing agents. |
| Refractive index: | 1.391-1.393 |
| Solubility: | 50 (g/l) |
| Appearance: | colorless to pale yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless, mobile liquid |
| Safety Data |
| Hazard Symbols |
F:Flammable
|
| |
 |
