| Identification | |
| Name: | 1,3-Dichloro-2-propanol |
| Synonyms: | Glycerol chlorohydrin; Dichloropropanol; 95%; Glycerol-alpha,gamma-dichlorohydrin; DCP; 1,3-dichloroisopropanol; 1,3-dichloro-propan-2-ol |
| CAS: | 96-23-1 |
| EINECS: | 202-491-9 |
| Molecular Formula: | C3H6Cl2O |
| Molecular Weight: | 128.98 |
| InChI: | InChI=1/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2750 |
| Density: | 1.351 |
| Stability: | Unstable. |
| Refractive index: | 1.482-1.484 |
| Solubility: | soluble. >=10 g/100 mL at 23 oC in water |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
? 1,3-Dichloro-2-propanol ,?its cas register number is 96-23-1. It also can be called?1,3-Dichloro-2-hydroxypropane ; 1,3-Dichlorohydrin ; 1,3-Dichloroisopropanol ; 2-Propanol, 1-3-dichloro- ; Dichlorohydrin ; Enodrin ; Gdch ; Glycerol 1,3-dichlorohydrin ; Glycerol alpha,gamma-dichlorohydrin ; Propylene dichlorohydrin ; Sym-dichloroisopropyl alcohol ; Sym-glycerol dichlorohydrin ; alpha-Propenyldichlorohydrin ; s-Dichloroisopropyl alcohol ; s-Glycerol dichlorohydrin ; sym-Dichloroisopropyl alcohol .?1,3-Dichloro-2-propanol (CAS NO.96-23-1) is a?colorless to yellow slightly viscous liquid with an ethereal odor. |
| Report: |
1,3-Dichloro-2-propanol is Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| HS Code: | 29055910 |
| Color: | COLORLESS, SLIGHTLY VISCOUS, LIQUID |
| Usage: | Solvent for hard resins and nitrocellulose, manufacture photographic and zapon lacquer, cement for celluloid, binder for watercolors. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
