| Identification | |
| Name: | Acetic acid, 2-hydroxy-, methyl ester |
| Synonyms: | Methyl hydroxyacetate;NSC 27786;Acetic acid, hydroxy-, methyl ester;Glycolic acid, methyl ester (8CI); |
| CAS: | 96-35-5 |
| EINECS: | 202-502-7 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1/C3H6O3/c1-6-3(5)2-4/h4H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.184 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.416-1.418 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | clear liquid |
| Specification: |
Acetic acid, 2-hydroxy-, methyl ester , its CAS NO. is 96-35-5 , the synonyms are Methyl glycolate ; Methyl hydroxyacetate ; NSC 27786 ; Acetic acid, hydroxy-, methyl ester ; Glycolic acid, methyl ester (8CI) . |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
