| Identification | |
| Name: | Phenol,2-amino-4,6-dinitro- |
| Synonyms: | 1-Amino-2-hydroxy-3,5-dinitrobenzene;1-Amino-3,5-dinitro-2-hydroxybenzene;1-Hydroxy-2-amino-4,6-dinitrobenzene;2,4-Dinitro-6-aminophenol;2-Amino-4,6-dinitrophenol;4,6-Dinitro-2-aminophenol;6-Amino-2,4-dinitrophenol;C.I. Oxidation Base 21;Fourrine 4R;Fourrine 93;Furro 4R;NSC 36939;NSC 4861;Zoba 4R; |
| CAS: | 96-91-3 |
| EINECS: | 202-544-6 |
| Molecular Formula: | C6H5N3O5 |
| Molecular Weight: | 199.12 |
| InChI: | InChI=1/C6H5N3O5/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14/h1-2,10H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3317 |
| Density: | 1.749 g/cm 3 |
| Stability: | Stable. Combustible - burns rapidly: dangerous fire risk. Do not subject to shock, friction or heat. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.73 |
| Water Solubility: | soluble (Soluble in most organic solvents) |
| Solubility: | soluble (Soluble in most organic solvents) |
| Appearance: | brown paste |
| Packinggroup: | II |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Dark red needles from alc, prisms from chloroform |
| Usage: | Chemical intermediate for dyes, esp mordant dyes, diazodinitrophenol, an explosive initiator, oxidn base for dyeing fur, component of electric detonation fuses, reagent for albumin, acid base indicator. |
| Safety Data | |
| Hazard Symbols |
4.1
(Packing Group:I)
UN
NO.
|
 |
|
