| Identification | |
| Name: | Benzeneacetic acid, a-[(3-ethoxy-1-methyl-3-oxo-1-propen-1-yl)amino]-,potassium salt (1:1), (aR)- |
| Synonyms: | Benzeneaceticacid, a-[(3-ethoxy-1-methyl-3-oxo-1-propenyl)amino]-,monopotassium salt, (R)-;Benzeneacetic acid, a-[(3-ethoxy-1-methyl-3-oxo-1-propenyl)amino]-,monopotassium salt, (aR)- (9CI);Crotonic acid, 3-[(a-carboxybenzyl)amino]-, 1-ethyl ester, monopotassium salt, D-(-)- (8CI);Potassium D-(1-ethoxycarbonylpropen-2-yl)-a-aminophenylacetate; |
| CAS: | 961-69-3 |
| EINECS: | 213-510-5 |
| Molecular Formula: | C14H17KNO4 |
| Molecular Weight: | 301.38 |
| InChI: | InChI=1/C14H17NO4.K/c1-3-19-12(16)9-10(2)15-13(14(17)18)11-7-5-4-6-8-11;/h4-9,13,15H,3H2,1-2H3,(H,17,18);/q;+1/p-1/b10-9-; |
| Molecular Structure: | ![(C14H17KNO4) Benzeneaceticacid, a-[(3-ethoxy-1-methyl-3-oxo-1-propenyl)amino]-,monopotassium salt, (R)-;Benzeneac...](https://img.guidechem.com/casimg/961-69-3.gif) |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 213.5°C |
| Boiling Point: | 429.4°Cat760mmHg |
| Density: | g/cm3 |
| Alpha: | -78 o (C=1,1N HCL) |
| Solubility: | Appearance:white to off white crystalline powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | white to off white crystalline powder |
| Specification: |
Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate (CAS NO.961-69-3) is also named as Benzeneacetic acid, alpha-((3-ethoxy-1-methyl-3-oxo-1-propenyl)amino)-, monopotassium salt, (R)- ; Dane Salt ; Benzeneacetic acid, alpha-((3-ethoxy-1-methyl-3-oxo-1-propen-1-yl)amino)-, potassium salt (1:1), (alphaR)- ; Benzeneacetic acid, alpha-((3-ethoxy-1-methyl-3-oxo-1-propenyl)amino)-, monopotassium salt, (alphaR)- . Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate (CAS NO.961-69-3) is white crystalline powder. |
| Flash Point: | 213.5°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
