| Identification | |
| Name: | 1,2-Ethanediamine,N1,N1-dimethyl-N2-phenyl-N2-(phenylmethyl)- |
| Synonyms: | 1,2-Ethanediamine,N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)- (9CI); Ethylenediamine,N-benzyl-N',N'-dimethyl-N-phenyl- (7CI,8CI); 2339 RP; Antergan; Bridal;Dimetina; Lergitin; N-Benzyl-N',N'-dimethyl-N-phenylethylenediamine; PM 245;Phenbenzamine |
| CAS: | 961-71-7 |
| Molecular Formula: | C17H22 N2 |
| Molecular Weight: | 254.41 |
| InChI: | InChI=1/C17H22N2/c1-18(2)13-14-19(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16/h3-12H,13-15H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 166.2°C |
| Boiling Point: | 375.9°Cat760mmHg |
| Density: | 1.038g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
N-Benzyl-N',N'-dimethyl-N-phenylethylenediamine (CAS NO.961-71-7) is also named as 2339 RP ; 4-12-00-02324 (Beilstein Handbook Reference) ; Antergan ; BRN 2738634 ; Bridal ; Dimetina ; Lergitin ; NCI-C60719 ; PM 245 ; PM245 ; Phenbenzamine ; RP 2339 ; 1,2-Ethanediamine, N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)- ; 1,2-Ethanediamine, N,N-dimethyl-N'-phenyl-N'-(phenylmethyl)- . N-Benzyl-N',N'-dimethyl-N-phenylethylenediamine (CAS NO.961-71-7) is liquid. N-Benzyl-N',N'-dimethyl-N-phenylethylenediamine neutralizes acids in exothermic reactions to form salts plus water. May be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen may be generated in combination with strong reducing agents, such as hydrides. N-Benzyl-N',N'-dimethyl-N-phenylethylenediamine is toxic. Hazardous decomposition products. So the storage environment should be ventilate, low-temperature and dry. Keep N-Benzyl-N',N'-dimethyl-N-phenylethylenediamine separate from raw materials of food. |
| Flash Point: | 166.2°C |
| Safety Data | |
 |
|
