| Identification |
| Name: | 4H-Dibenzo[de,g]quinolin-10-ol,5,6,6a,7-tetrahydro-11-methoxy-6-propyl-, (R)- (9CI) |
| Synonyms: | N-Demethyl-N-propylisoapocodeine;N-Propylnorisoapocodeine |
| CAS: | 96158-78-0 |
| Molecular Formula: | C20H23 N O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H23NO2/c1-3-10-21-11-9-13-5-4-6-15-18(13)16(21)12-14-7-8-17(22)20(23-2)19(14)15/h4-8,16,22H,3,9-12H2,1-2H3/t16-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 240.3°C |
| Boiling Point: | 473.7°Cat760mmHg |
| Density: | 1.166g/cm3 |
| Refractive index: | 1.609 |
| Flash Point: | 240.3°C |
| Safety Data |
| |
 |