| Identification | |
| Name: | a-D-Glucopyranoside, methyl |
| Synonyms: | Glucopyranoside,methyl, a-D- (8CI);1-O-Methyl-a-D-glucopyranoside;1-O-Methyl-a-D-glucoside;1-O-Methyl-a-glucopyranoside;Methyl a-D-(+)-glucoside;Methyl a-D-glucopyranoside;Methyl a-D-glucoside;Methyl a-glucopyranoside;NSC 102101;NSC214092;a-Methyl D-glucose ether;a-Methylglucoside; |
| CAS: | 97-30-3 |
| EINECS: | 202-571-3 |
| Molecular Formula: | C7H14O6 |
| Molecular Weight: | 194.18 |
| InChI: | InChI=1/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.46 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 157.5 ° (C=10, H2O) |
| Alpha: | 158.9 º (C=10, WATER) |
| Solubility: | 108 g/100 mL (20 ºC) in water |
| Appearance: | White Powder |
| Specification: |
alpha-D-Methylglucoside , its cas register number is 97-30-3. It also can be called AI3-18790 ; Methyl alpha-D-glucopyranoside ; Methyl alpha-D-glucoside (VAN) ; Methyl-alpha-D-glucopyranoside ; NSC 102101 ; alpha-Methyl D-glucose ether ; alpha-Methyl-D-glucoside ; alpha-Methyl-d-glucoside ; alpha-Methylglucoside . alpha-D-Methylglucoside (CAS NO.97-30-3) is a white powder. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Usage: | Production of reconstituted and upgraded drying oils. |
| Safety Data | |
 |
|
