| Identification | |
| Name: | Isoeugenol |
| Synonyms: | 1-Hydroxy-2-methoxy-4-propen-1-yl benzene; 1-hydroxy-2-methoxy-4-propenyl-(cis)benzene; 2-Methoxy-4-(1-propenyl) phenol; 2-Methoxy-4-propenylphenol; 4-Hydroxy-3-methoxy-1-propenylbenzene; 4-Propenyl-2-methoxyphenol; 4-Propenylguaiacol; Isoeugenol, mixture of cis/trans isomers; |
| CAS: | 97-54-1 |
| EINECS: | 202-590-7 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3-7,11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112 ºC |
| Density: | 1.08 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.575 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed. Eye and respiratory irritant. Severe skin irritant. Toxicity data ( |
| Solubility: |
|
| Appearance: | light yellow-green viscous liquid |
| Flash Point: | 112 ºC |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
