Identification |
Name: | Ethyl Methacrylate |
Synonyms: | 2-Methyl-2-Propenoic Acid Ethyl Ester; ethyl 2-methyl-2-propenoate; ethyl alpha-methylacrylate; Methacrylic Acid Ethyl Ester; Rhoplex ac-33; 2-methyl-2-propenoicacid,ethylester; 2-methyl-2-propenoicaciethylester; 2-Methylacrylic acid, ethyl ester; 2-methyl-prop-2-enoicacidethylester; 2-Propenoicacid,2-methyl-,ethylester; EMA; Ethyl 2-methacrylate |
CAS: | 97-63-2 |
EINECS: | 202-597-5 |
Molecular Formula: | C6H10O2 |
Molecular Weight: | 114.14 |
InChI: | InChI=1/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2277 |
Density: | 0.917 |
Stability: | Polymerizes in the presence of light or heat. Incompatible with peroxides, oxidizing agents, bases, acids, reducing agents, halogens and amines. Flammable. |
Refractive index: | 1.413-1.415 |
Solubility: | 4 g/L (20 ºC) |
Appearance: | colourless liquid with an unpleasant odour(well known as Plexiglass in the polymerized form) |
Packinggroup: | II |
HS Code: | 29161490 |
Color: | Colorless, liquid |
Usage: | Ethyl methacrylate is used to make polymers, which in turn are used for building, automotive, aerospace, and furniture industries. |
Safety Data |
Hazard Symbols |
F:Flammable
Xi:Irritant
|
|
|