| Identification | |
| Name: | Tetraethylthiuram disulfide |
| Synonyms: | bis(diethylthiocarbamoyl) disulfide; disulfiram; tetd; tetraethylthiuram disulphide; accelerator tetd; bis (diethylthiocarbamyl) disulfide; tetraethyl thiuram disulfide; ethylthiudad; ethyltuex; etyl tuex; exhoran; exhorran; formamide, 1,1'-dithiobis(n,n-diethylthio)-; hoca; hocakrotenalnci-c02959; hydrogendisulfide; hydrogenpersulfid; krotenal; n,n,n',n'-tetraethylthiuram disulfide; n,n,n',n'-tetraethylthiuram disulphide; n,n,n',n'-tetraethylthiuramdisulphide; nci-c02959; nocbin; nsc 190940; nsc190940; perkacit tetd; perkait tetd; |
| CAS: | 97-77-8 |
| EINECS: | 202-607-8 |
| Molecular Formula: | C10H20N2S4 |
| Molecular Weight: | 296.52 |
| InChI: | InChI=1/C10H20N2S4/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2588/3077 |
| Density: | 1.27 |
| Stability: | Stable. Incompatible with strong oxidants. |
| Refractive index: | 1.6126 (84 C) |
| Water Solubility: | 0.02 g/100 mL |
| Solubility: | 0.02 g/100 mL in water |
| Appearance: | yellow-white crystals or grey powder |
| Packinggroup: | III |
| HS Code: | 29303000 |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | WHITE TO OFF-WHITE CRYSTALLINE POWDER Light-gray powder White, yellowish, or light-gray powder. |
| Usage: | Alcohol aversive drug. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
