| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, butyl ester |
| Synonyms: | Methacrylicacid, butyl ester (6CI,8CI);2-Methyl-2-propenoic acid butyl ester;AcryesterB;Blemmer BMA;Butyl 2-methyl-2-propenoate;Butyl 2-methylacrylate;Butylmethacrylate;Light Ester NB;N 212;NSC 20956;n-Butyl methacrylate;n-Batyl methacrylate; |
| CAS: | 97-88-1 |
| EINECS: | 202-615-1 |
| Molecular Formula: | C8H14O2 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C8H14O2/c1-4-5-6-10-8(9)7(2)3/h2,4-6H2,1,3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2227 |
| Density: | 0.894 |
| Stability: | Stable (though if no stabilizers are present, it may polymerize; typically stabilized through the addition of HQME). Incompatible with strong reducing agents, strong oxidizing agents. Flammable. Water-reactive at high or low pH. |
| Refractive index: | 1.4225-1.4245 |
| Solubility: | 3 g/L (20 oC) |
| Appearance: | clear colourless liquid with an ester-like odour |
| Packinggroup: | III |
| HS Code: | 29161490 |
| Usage: | Monomer for resins, solvent coatings, adhesives, oil additives, emulsions for textiles, leather & paper finishing. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
