| Identification |
| Name: | Propanoic acid,2-methyl-, 3,7-dimethyl-6-octen-1-yl ester |
| Synonyms: | Isobutyricacid, 3,7-dimethyl-6-octenyl ester (8CI); Isobutyric acid, ester withcitronellol (6CI); Propanoic acid, 2-methyl-, 3,7-dimethyl-6-octenyl ester(9CI); 2,6-Dimethyl-2-octen-8-yl isobutyrate; Citronellyl isobutyrate; NSC46148 |
| CAS: | 97-89-2 |
| EINECS: | 202-616-7 |
| Molecular Formula: | C14H26 O2 |
| Molecular Weight: | 226.355 |
| InChI: | InChI=1/C14H26O2/c1-11(2)7-6-8-13(5)9-10-16-14(15)12(3)4/h7,12-13H,6,8-10H2,1-5H3/t13-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Refractive index: | n20/D 1.442(lit.) |
| Solubility: | miscible with alcohol, ether, chloroform and most of the non-volatile oil, and almost insoluble in water |
| Appearance: | Colorless liquid |
| Safety Data |
| |
 |
