| Identification |
| Name: | Ethylene Glycol Dimethacrylate |
| Synonyms: | Ethylene dimethacrylate |
| CAS: | 97-90-5 |
| EINECS: | 202-617-2 |
| Molecular Formula: | C10H14O4 |
| Molecular Weight: | 198.22 |
| InChI: | InChI=1/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.051 |
| Stability: | Unstable - may polymerize upon exposure to light. Incompatible with strong acids, strong oxidizing agents, strong bases. |
| Refractive index: | 1.453-1.455 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | COLOURLESS LIQUID |
| HS Code: | 29161490 |
| Usage: | Srp: in polymers for dental restorative resins, in synthetic wound dressings, as rate-controlling barrier in slow release capsules, in acrylic nail prepn. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
