| Identification | |
| Name: | Cumene |
| Synonyms: | 2-Phenylpropane; isopropylbenzene; methyl ethyl benzene; |
| CAS: | 98-82-8 |
| EINECS: | 202-704-5 |
| Molecular Formula: | C9H12 |
| Molecular Weight: | 120.19 |
| InChI: | InChI=1/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1918 |
| Density: | 0.862 |
| Stability: | Stable, but may form peroxides in storage if in contact with the air. Test for the presence of peroxides before heating or distilling. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4905-1.4925 |
| Solubility: | Sol in acetone, ether, ethanol In water, 50 mg/l at 20 deg C Soluble in most organic solvents; insoluble in water. Soluble in many organic solvents In water, 61.3 mg/l @ 25 deg C. |
| Appearance: | colourless liquid |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | Colorless liquid Colorless liquid ... |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
