| Identification |
| Name: | Pyridine,2-chloro-6-(4-piperidinylthio)- |
| Synonyms: | Anpirtoline |
| CAS: | 98330-05-3 |
| Molecular Formula: | C10H13 Cl N2 S |
| Molecular Weight: | 228.7416 |
| InChI: | InChI=1/C10H13ClN2S.ClH/c11-9-2-1-3-10(13-9)14-8-4-6-12-7-5-8;/h1-3,8,12H,4-7H2;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 174 ºC |
| Boiling Point: | 364.1 ºC at 760 mmHg |
| Density: | 1.27 g/cm3 |
| Biological Activity: | Highly potent 5-HT 1B receptor agonist (K i values are 28, 150 and 1490 nM at 5-HT 1B , 5-HT 1A and 5-HT 2 receptors respectively). Decreases central serotonin synthesis and attenuates aggressive behavior in vivo . Also acts as an antagonist at 5-HT 3 receptors (K i = 29.5 nM) and is brain penetrant. |
| Flash Point: | 174 ºC |
| Safety Data |
| |
 |