| Identification | |
| Name: | 2,4-Dichloro-5-methoxyaniline |
| Synonyms: | 2,4-dichloro-5-methoxy-aniline;2,4-Dichloro-5-methoxybenzenamine;2,4-dichloro-5-methoxy aniline; |
| CAS: | 98446-49-2 |
| Molecular Formula: | C7H7Cl2NO |
| Molecular Weight: | 192.04 |
| InChI: | InChI=1/C7H7Cl2NO/c1-11-7-3-6(10)4(8)2-5(7)9/h2-3H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Melting Point: | 51ºC |
| Flash Point: | 129.3ºC |
| Boiling Point: | 290.1ºC at 760 mmHg |
| Density: | 1.375 g/cm3 |
| Refractive index: | 1.587 |
| Appearance: | White or off-white powder |
| Specification: |
2,4-Dichloro-5-methoxyaniline ,its cas register number is 98446-49-2. It also can be called 5-Amino-2,4-dichloroanisole ; Benzenamine, 2,4-dichloro-5-methoxy- and 1-Amino-2,4-dichloro-5-methoxybenzene . |
| Packinggroup: | III |
| Flash Point: | 129.3ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
