| Identification |
| Name: | 1H-Tetrazole,5-(4-chlorobutyl)-1-[4-(phenylmethoxy)cyclohexyl]-, trans- (9CI) |
| Synonyms: | 1-(trans-4-Benzyloxycyclohexyl)-5-(4-chlorobutyl)-1H-tetrazole;trans-5-(4-Chlorobutyl)-1-[4-(phenylmethoxy)cyclohexyl]-1H-tetrazole |
| CAS: | 98454-50-3 |
| Molecular Formula: | C18H25 Cl N4 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H25ClN4O/c19-13-5-4-8-18-20-21-22-23(18)16-9-11-17(12-10-16)24-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2/t16?,17- |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 102-1030C |
| Flash Point: | 276.396°C |
| Boiling Point: | 533.409°C at 760 mmHg |
| Density: | 1.257g/cm3 |
| Refractive index: | 1.616 |
| Flash Point: | 276.396°C |
| Usage: | Intermediate of OPC-13013, a metabolite of Cilostazol |
| Safety Data |
| |
 |