| Identification | |
| Name: | 3-Dimethylaminophenol |
| Synonyms: | N,N-Dimethyl-3-aminophenol; 3-(Dimethylamino)-phenol |
| CAS: | 99-07-0 |
| EINECS: | 202-727-0 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-9(2)7-4-3-5-8(10)6-7/h3-6,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 70kg in |
| Density: | 1.089 g/cm3 |
| Stability: | Stable. May be air-sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5895 (26 C) |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | dissolved in ethanol, ether, benzene, acetone, alkali, and inorganic acid,not almost soluble in water |
| Appearance: | gray powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29222900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Light Sensitive |
| Color: | violet |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
