| Identification | |
| Name: | 3,5-Dinitrobenzoic acid |
| Synonyms: | 3,5-Dinitrobenzoic Acid (1.00138); ACID 3,5-DINITROBENZOIQUE |
| CAS: | 99-34-3 |
| EINECS: | 202-751-1 |
| Molecular Formula: | C7H4N2O6 |
| Molecular Weight: | 212.12 |
| InChI: | InChI=1/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN1325 |
| Flash Point: | 179.2°C |
| Boiling Point: | 395.5°Cat760mmHg |
| Density: | 1.683 |
| Stability: | Stable. Contact with strong bases may lead to fire. Incompatible with strong bases, strong oxidizing agents. |
| Solubility: | 1350 mg/L (25 oC) |
| Appearance: | Yellow solid. |
| Packinggroup: | III |
| HS Code: | 29163900 |
| Flash Point: | 179.2°C |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Usage: | Identification of alcohols, alkyl halides. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
