| Identification | |
| Name: | Benzenamine,2-methoxy-5-nitro- |
| Synonyms: | o-Anisidine,5-nitro- (8CI);(2-Methoxy-5-nitrophenyl)amine;1-Amino-2-methoxy-5-nitrobenzene;1-Methoxy-2-amino-4-nitrobenzene;2-(Methyloxy)-5-nitroaniline;2-Amino-1-methoxy-4-nitrobenzene;2-Amino-4-nitroanisole;2-Methoxy-5-nitroaniline;2-Methoxy-5-nitrobenzenamine;3-Nitro-6-methoxyaniline;4-Nitro-2-aminoanisole;5-Nitro-2-methoxyaniline;5-Nitro-o-anisidine;Azoamine Scarlet K;NSC 5510; |
| CAS: | 99-59-2 |
| EINECS: | 202-770-5 |
| Molecular Formula: | C7H8N2O3 |
| Molecular Weight: | 168.15 |
| InChI: | InChI=1/C7H8N2O3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 166.6°C |
| Boiling Point: | 351.8°Cat760mmHg |
| Density: | 1.2068 |
| Stability: | Stable, but may be moisture sensitive. Incompatible with water, acids, strong oxidizing agents, acid chlorides, acid anhydrides, chloroformates, liquid anisidine. |
| Water Solubility: | Slightly soluble. |
| Solubility: | Slightly soluble. <0.01 g/100 mL at 19.5 ºC |
| Appearance: | orange to brown powder |
| Packinggroup: | I; II; III |
| Flash Point: | 166.6°C |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | ORANGE-RED NEEDLES FROM ALC, ETHER, WATER Red needles from alcohol |
| Usage: | Chemical intermediate for dyes and pigments (eg, ci pigment red 23), component in azoic dye compositions for cotton and nylon, acetate and silk. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
