| Identification |
| Name: | 3-Nitrobenzaldehyde |
| Synonyms: | m-Nitrobenzaldehyde |
| CAS: | 99-61-6 |
| EINECS: | 202-772-6 |
| Molecular Formula: | C7H5NO3 |
| Molecular Weight: | 151.12 |
| InChI: | InChI=1/C7H5NO3/c9-5-6-2-1-3-7(4-6)8(10)11/h1-5H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Boiling Point: | 164 C at 23 mm Hg |
| Density: | 16423 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.617 |
| Water Solubility: | 1630 mg/L at 25 C |
| Solubility: | 1630 mg/L at 25 C |
| Appearance: | Yellowish to brownish crystalline powder or granulate |
| Packinggroup: | Z01 |
| HS Code: | 29130000 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
