| Identification |
| Name: | Cyclohexane,1-methyl-4-(1-methylethyl)- |
| Synonyms: | p-Menthane(6CI,7CI,8CI);1-Methyl-4-isopropylcyclohexane;4-Methyl-1-(1-methylethyl)cyclohexane; |
| CAS: | 99-82-1 |
| EINECS: | 202-790-4 |
| Molecular Formula: | C10H20 |
| Molecular Weight: | 140.26 |
| InChI: | InChI=1/C10H20/c1-8(2)10-6-4-9(3)5-7-10/h8-10H,4-7H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3295 |
| Flash Point: | 44.7°C |
| Density: | 0.785g/cm3 |
| Stability: | Stable. Flammable - may form explosive mixtures with air. Incompatible with strong oxidizng agents. |
| Solubility: | negligible |
| Appearance: | colourless liquid |
| Flash Point: | 44.7°C |
| Safety Data |
| |
 |
