| Identification |
| Name: | 1,3-Cyclohexadiene,1-methyl-4-(1-methylethyl)- |
| Synonyms: | p-Mentha-1,3-diene(8CI);1-Isopropyl-4-methyl-1,3-cyclohexadiene;1-Methyl-4-isopropyl-1,3-cyclohexadiene;4-Isopropyl-1-methyl-1,3-cyclohexadiene;Terpilene;a-Terpinen; |
| CAS: | 99-86-5 |
| EINECS: | 202-795-1 |
| Molecular Formula: | C10H16 |
| Molecular Weight: | 136.26 |
| InChI: | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8H,5,7H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2319 3/PG 3 |
| Flash Point: | 46.1°C |
| Boiling Point: | 174.1°Cat760mmHg |
| Density: | 0.845g/cm3 |
| Refractive index: | n20/D 1.478(lit.) |
| Solubility: | miscible with ethanol, ethyl ether, hardly soluble in water |
| Appearance: | Colorless oily liquid with lemon odor |
| Packinggroup: | III |
| Flash Point: | 46.1°C |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
