| Identification | |
| Name: | 4'-Bromoacetophenone |
| Synonyms: | 1-(4-Bromophenyl)ethanone; 1-Acetyl-4-bromobenzene; p-Bromo acetophenone,98%; 4-Bromoacetophenone; 4'-Bromoacetophene |
| CAS: | 99-90-1 |
| EINECS: | 202-799-3 |
| Molecular Formula: | C8H7BrO |
| Molecular Weight: | 199.05 |
| InChI: | InChI=1/C8H7BrO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Flash Point: | 94.3 oC |
| Density: | 1.64 |
| Stability: | No data. |
| Refractive index: | 1.647 (20 C) |
| Water Solubility: | methanol: 0.1 g/mL, clear |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | white crystal |
| Specification: |
?4'-Bromoacetophenone (CAS NO.99-90-1) is also called as? 4-Bromoacetophenone ; p-Bromoacetophenone?; Methyl p-bromophenyl ketone ;?p-Bromophenyl methyl ketone ; Acetophenone, 4'-bromo- (8CI) ; Ethanone, 1-(4-bromophenyl)- . |
| Packinggroup: | I; II; III |
| HS Code: | 29147090 |
| Flash Point: | 94.3 oC |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
