| Identification | ||
| Name: | p-Toluic acid | |
| Synonyms: | 4-Methylbenzoic acid; p-toluylic acid; crithminic acid; Toluenecarboxylic acid; p-methylbenzoic acid | |
| CAS: | 99-94-5 | |
| EINECS: | 202-803-3 | |
| Molecular Formula: | C8H8O2 | |
| Molecular Weight: | 136.15 | |
| InChI: | InChI=1/C8H8O2/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3,(H,9,10) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.06 | |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. | |
| Refractive index: | 1.5086 (20 C) | |
| Water Solubility: | <0.1 g/100 mL at 19 ºC | |
| Solubility: | <0.1 g/100 mL at 19 oC | |
| Appearance: | colourless crystals or white crystalline powder | |
| Report: |
Reported in EPA TSCA Inventory. | |
| Packinggroup: | Z01 | |
| HS Code: | 29163900 | |
| Storage Temperature: | Store at RT. | |
| Usage: | Intermediates of Liquid Crystals | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
