| Identification | |
| Name: | 4-Ethoxycarbonyl-3-ethoxyphenyla-cetic acid |
| Synonyms: | 3-Ethoxy-4-(ethoxycarbonyl)benzeneaceticacid;Ethyl 4-carboxymethyl-2-ethoxybenzoate;[3-Ethoxy-4-(ethoxycarbonyl)phenyl]aceticacid;3-Ethoxy-4-ethoxycarbonylphenyl acetic acid; |
| CAS: | 99469-99-5 |
| EINECS: | 427-630-2 |
| Molecular Formula: | C13H16O5 |
| Molecular Weight: | 252.26 |
| InChI: | InChI=1/C13H16O5/c1-4-16-12-8-10(18-9(3)14)6-7-11(12)13(15)17-5-2/h6-8H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.191 |
| Refractive index: | 1.5 |
| Appearance: | white to pale yellow solid |
| Specification: |
?4-Ethoxycarbonyl-3-ethoxyphenyla-cetic acid , its CAS NO. is 99469-99-5, the synonyms are 3-Ethoxy-4-(ethoxycarbonyl)benzeneacetic acid ; 2-[(4-Ethoxycarbonyl)-3-ethoxyphenyl] acetic acid . |
| Usage: | 4-Ethoxycarbonyl-3-ethoxyphenyla-cetic acid (CAS NO.99469-99-5) is used as an intermediate for the synthesis of Repaglinide. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
