| Identification | |
| Name: | 2-Propenoic acid,2-hydroxypropyl ester |
| Synonyms: | Acrylicacid, 2-hydroxypropyl ester (6CI,8CI);1,2-Propanediol, 1-acrylate (8CI);2-Hydroxypropyl acrylate;2HPA;Bisomer HPA;HOP-A;HPA;Kayarad HPA;LightEster HOP-A;b-Hydroxypropylacrylate;2-propenoic acid, 2-hydroxypropyl ester; |
| CAS: | 999-61-1 |
| EINECS: | 213-663-8 |
| Molecular Formula: | C6H10O3 |
| Molecular Weight: | 130.16 |
| InChI: | InChI=1/C6H10O3/c1-3-6(8)9-4-5(2)7/h3,5,7H,1,4H2,2H3/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2927 |
| Melting Point: | Freezing point: -30 deg C |
| Density: | 1.049 g/cm3 |
| Refractive index: | 1.442 |
| Water Solubility: | 150,000 mg l-1 (e) |
| Solubility: | Water soluble Miscible with water and oxygenated solvents In water, 4.5X10+5 mg/L at 25 deg C (est) |
| Packinggroup: | II |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
TLV: 0.5
|
 |
|
