| Identification |
| Name: | hydrogen peroxide; peroxyacetic acid; sulfuric acid |
| Synonyms: | Persteril;AC1MIVFO;ethaneperoxoic acid; hydrogen peroxide; sulfuric acid;Ethaneperoxoic acid, mixt. with hydrogen peroxide (H2O2) and sulfuric acid;8066-16-8 |
| CAS: | 12738-31-7;8066-16-8;8071-18-9 |
| Molecular Formula: | C2H8O9S |
| Molecular Weight: | 208.1445 |
| InChI: | InChI=1/C2H4O3.H2O4S.H2O2/c1-2(3)5-4;1-5(2,3)4;1-2/h4H,1H3;(H2,1,2,3,4);1-2H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 54.9°C |
| Boiling Point: | 119.1°C at 760 mmHg |
| Flash Point: | 54.9°C |
| Safety Data |
| |
 |
