| Identification |
| Name: | Mycophenolate mofetil |
| Synonyms: | AKOS 92025; 4-HEXENOIC ACID,6-(1,3-DIHYDRO-4-HYDROXY-6-METHOXY-7-METHYL-3-OXO-5-ISOBENZOFURANYL)-4-METHYL-,2-(4-MORPHOLINYL)ETHYL ESTER; MMF; 2-Morpholin-4-ylethyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-isobenzofuran-5-yl)-4-methyl-hex-4-enoate; Mycophenolate Mofetil(MMF); 6-[(7-hydroxy-5-methoxy-4-methyl-1-oxo-3h-isobenzofuran-6-yl)]-4-methyl-hex-4-enoic acid 2-morpholinoethyl ester; Macophenolate Mofetil; MycophenolicAcid-2-(4-Morpholinyl)ethylEster; Mycophenolate |
| CAS: | 115007-34-6;128794-94-5 |
| Molecular Formula: | C23H31NO7 |
| Molecular Weight: | 433.49 |
| InChI: | InChI=1/C23H31NO7/c1-15(5-7-19(25)30-13-10-24-8-11-29-12-9-24)4-6-17-21(26)20-18(14-31-23(20)27)16(2)22(17)28-3/h4,26H,5-14H2,1-3H3/b15-4+ |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 93-94 deg C |
| Density: | 1.222g/cm3 |
| Refractive index: | 1.557 |
| Solubility: | Freely soluble in acetone, soluble in methanol, and sparingly soluble in ethanol In water, 43 mg/L at pH 7.4, temp not specified |
| Color: | White to off-white crystalline powder |
| Safety Data |
| |
 |