Identification |
Name: | tris(2-ethylhexyl) phosphite - dibromomercury (1:1) |
Synonyms: | Mercury(II) bromide complex with tris(2-ethylhexyl) phosphite;tris(2-ethylhexyl) phosphite- dibromomercury(1:1);Phosphorous acid, tris(2-ethylhexyl) ester, complex with mercury(II) bromide (1:1);AC1L3HH2;AC1Q23SZ;AR-1L7696;NSC407793;NSC-407793;LS-109029;dibromomercury; tris(2-ethylhexyl) phosphite;64011-37-6 |
CAS: | 64011-37-6;7770-18-5 |
Molecular Formula: | C24H51Br2HgO3P |
Molecular Weight: | 779.0317 |
InChI: | InChI=1/C24H51O3P.2BrH.Hg/c1-7-13-16-22(10-4)19-25-28(26-20-23(11-5)17-14-8-2)27-21-24(12-6)18-15-9-3;;;/h22-24H,7-21H2,1-6H3;2*1H;/q;;;+2/p-2 |
Molecular Structure: |
|
Properties |
Flash Point: | 278.6°C |
Boiling Point: | 446.7°C at 760 mmHg |
Flash Point: | 278.6°C |
Safety Data |
|
|