| Identification |
| Name: | acrylic acid; 2-dimethylaminoethanol; ethylene |
| Synonyms: | acrylic acid; 2-dimethylaminoethanol; ethylene;125998-60-9;AC1Q5RAC;AC1L54WR;AR-1H6518;2-Propenoic acid, polymer with ethene, compd. with 2-(dimethylamino)ethanol;2-(dimethylamino)ethanol; ethene; prop-2-enoic acid;Acrylic acid, ethylene polymer, N,N-dimethylethanolamine salt;38531-18-9 |
| CAS: | 125998-60-9;38531-18-9;40471-13-4 |
| Molecular Formula: | C9H19NO3 |
| Molecular Weight: | 189.2521 |
| InChI: | InChI=1/C4H11NO.C3H4O2.C2H4/c1-5(2)3-4-6;1-2-3(4)5;1-2/h6H,3-4H2,1-2H3;2H,1H2,(H,4,5);1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 40.6°C |
| Boiling Point: | 135°C at 760 mmHg |
| Flash Point: | 40.6°C |
| Safety Data |
| |
 |