| Identification | |
| Name: | Inulin |
| Synonyms: | Alantstarch; Alantin; Beneo; Beneo GR; Beneo HP; Beneo ST; Dahlin; Fibruline;Fibruline Instant; Fibruline LC; Fibruline Long Chain; Fibrulose; Frutafit;Frutafit EXL; Frutafit HD; Frutafit IQ; Frutafit TEX; Frutagave PR 95;Frutagave SP 70; Fuji FF; Inulin HD; Inulin IQ; Inutec N 10; Inutec N 10GR;Inutec N 25; LV 110; Oliggo-Fiber F 97; Oliggo-Fiber XL; Raftifeed IPS; Raftiline;Raftiline GR; Raftiline HP; Raftiline LS; Raftiline ST; Sinantrin; Synantherin;Synanthrin; Synantrin; Ticaloid LC-CSR 2 |
| CAS: | 9005-80-5 |
| EINECS: | 232-684-3 |
| Molecular Formula: | C12H22O11.C6H12O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1,35 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.665? |
| Solubility: | Miscible with alcohol (decomposition). Miscible with ether, acetone, benzene, carbon tetrachloride, chlorobenzene, diglycol monomethyl ether, kerosene, olive oil; sol in ethyl acetate. |
| Appearance: | White powder |
| Specification: |
Inulin , its cas register number is 9005-80-5. It is uniquely treated by nephrons in that it is completely filtered at the glomerulus but neither secreted nor reabsorbed by the tubules, and is useful to contrast the properties of inulin with those of para-aminohippuric acid (PAH). Inulin (CAS NO.9005-80-5) is indigestible by the human enzymes ptyalin and amylase, and is only in the colon that bacteria metabolise inulin, with the release of significant quantities of carbon dioxide, hydrogen, and/or methane. It is typically found in roots or rhizomes. |
| Report: |
Inulin is reported in EPA TSCA Inventory. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | A WATER-WHITE LIQ WHICH TURNS STRAW-COLORED ON STANDING Clear to light yellow liq or crystals Colorless to pale yellow, solid or liquid (above 71 deg F). |
| Safety Data | |
 |
|
