| Identification | |
| Name: | trans-4-Methylcyclohexylamine |
| Synonyms: | HEXAHYDRO-P-TOLUIDINE; 4-METHYLCYCLOHEXYLAMINE; 4-methylcyclohexylamine, mixed isomers; 4-METHYLCYCLOHEXYLAMINE, 97%, MIXTURE OF CIS AND TRANS; 4-MethylmorpholineN-OxideIn50%Solution; 1-Amino-4-methylcyclohexane; 4-Methylcyclohexylamine, mixture of cis and trans, 97%; 4-METHYLCYCLOHEXAMINE |
| CAS: | 6321-23-9;2523-55-9 |
| EINECS: | 228-673-8 |
| Molecular Formula: | C7H15N |
| Molecular Weight: | 113.2 |
| InChI: | InChI=1/C7H15N/c1-6-2-4-7(8)5-3-6/h6-7H,2-5,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.85 |
| Refractive index: | 1.449 |
| Appearance: | clear colourless liquid |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
