| Identification | |
| Name: | Disulfide,bis(4-nitrophenyl)- |
| Synonyms: | Disulfide,bis(p-nitrophenyl) (7CI,8CI);4,4'-Dinitrodiphenyl disulfide;Bis(4-nitrophenyl) disulfide;Bis(p-nitrophenyl) disulfide;Di(p-nitrophenyl)disulfide;Di-4-nitrophenyl disulfide;NSC 4566;NSC 677446;p,p'-Dinitrodiphenyl disulfide;p-Nitrophenyl disulfide; |
| CAS: | 100-32-3 |
| EINECS: | 202-840-5 |
| Molecular Formula: | C12H8N2O4S2 |
| Molecular Weight: | 308.34 |
| InChI: | InChI=1/C12H8N2O4S2/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 243.4°C |
| Boiling Point: | 478.8°Cat760mmHg |
| Density: | 1.52g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.718 |
| Appearance: | yellow or tan powder |
| Specification: |
4,4'-Dinitrodiphenyl disulfide (100-32-3) also can be called P-Nitrophenyl disulfide ; Disulfide, bis(4-nitrophenyl) ; Bis(4-nitrophenyl) disulfide ; Di-4-nitrophenyl disulfide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 243.4°C |
| Usage: | Reactant or reagent involved in:• ;Electrophilic cyclization of 2-alkynylanisoles1 or alkynylanilines2• ;Oxidative chlorination to sulfonyl chlorides3• ;Arylation with triarylbismuthanes4• ;Decarboxylative cross-coupling with dialkoxybenzoic acids5• ;Disulfidation of alkenes6 |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
