| Identification |
| Name: | Disulfide,bis(2-nitrophenyl) |
| Synonyms: | Disulfide,bis(o-nitrophenyl) (7CI,8CI);2,2'-Dinitrodiphenyl disulfide;Bis(o-nitrophenyl) disulfide;NSC 203;NSC646126;o,o'-Dinitrodiphenyl disulfide;o-Nitrophenyl disulfide; |
| CAS: | 1155-00-6 |
| EINECS: | 214-581-5 |
| Molecular Formula: | C12H8N2O4S2 |
| Molecular Weight: | 308.33 |
| InChI: | InChI=1/C12H8N2O4S2/c15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-8H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 221.1 ºC |
| Boiling Point: | 441.9 ºC at 760 mmHg |
| Density: | 1.52 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.718 |
| Appearance: | Yellow to green powder. |
| Flash Point: | 221.1 ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
