| Identification | |
| Name: | Triphenyl phosphite |
| Synonyms: | Triphenyl Phosphite (TPPi); Triphenyl phospite; Triphenylphosphite white yellow xtl; Triphenyl Phosphine Oxide |
| CAS: | 101-02-0 |
| EINECS: | 202-908-4 |
| Molecular Formula: | C18H15O3P |
| Molecular Weight: | 310.29 |
| InChI: | InChI=1/C18H15O3P/c1-4-10-16(11-5-1)19-22(20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18/h1-15H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.184 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5893-1.5913 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | colourless to pale yellow liquid |
| Specification: |
? Triphenyl phosphite , with CAS number of 101-02-0, can be called phosphorous acid, triphenyl ester ; Advance TPP ; Phenyl phosphite ; Sumilizer TPP-R ; Trifenoxyfosfin ; Tris(phenoxy)phosphine . It is a colourless to pale yellow liquid, be insoluble in water. Triphenyl phosphite (CAS NO.101-02-0) are susceptible to form highly toxic and flammable phosphine gas in the presence of strong reducing agents, such as hydrides. Partial oxidation may result in the release of toxic phosphorus oxides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29209085 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air & Moisture Sensitive |
| Color: | Water-white to pale yellow solid or oily liquid |
| Usage: | Chemical intermediate, stabilizer systems for resins, metal scavenger, diluent for epoxy resins. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
 |
|
