| Identification | |
| Name: | Milnacipran hydrochloride |
| Synonyms: | Cyclopropanecarboxamide,2-(aminomethyl)-N,N-diethyl-1-phenyl-, monohydrochloride, (1R,2S)-rel- (9CI);Milnacipran HCl;Cyclopropanecarboxamide, 2-(aminomethyl)-N,N-diethyl-1-phenyl-,monohydrochloride, cis-;Dalcipran;F 2207;Ixel;Cyclopropanecarboxamide,2-(aminomethyl)-N,N-diethyl-1-phenyl-, hydrochloride (1:1), (1R,2S)-rel-;Toledomin; |
| CAS: | 101152-94-7 |
| Molecular Formula: | C15H23ClN2O |
| Molecular Weight: | 282.80892 |
| InChI: | InChI=1S/C15H22N2O.ClH/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12;/h5-9,13H,3-4,10-11,16H2,1-2H3;1H/t13-,15+;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Water Solubility: | 19 mg/mL in water |
| Solubility: | 19 mg/mL in water |
| Appearance: | White crystalline powder |
| Biological Activity: | Orally active 5-HT and noradrenalin re-uptake inhibitor (SNRI) (IC 50 values are 203 and 100 nM respectively) that displays no affinity at a range of other receptors. Causes adaptive changes to α 1 -adrenergic and 5-HT 2A serotonergic systems when administered repeatedly. Exhibits antidepressive and antinociceptive activities in vivo . |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | Antidepressant |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
