| Identification | |
| Name: | Guanidine hydrochloride |
| Synonyms: | Guanidine,monohydrochloride (8CI,9CI);Buffer AL;Guanidine chloride;Guanidinehydrochloride;Guanidinium chloride;Guanidinium hydrochloride; |
| CAS: | 50-01-1 |
| EINECS: | 200-002-3 |
| Molecular Formula: | CH5N3.HCl |
| Molecular Weight: | 95.53 |
| InChI: | InChI=1/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.34 |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.465 |
| Solubility: | 2280 g/L (20 oC) in water |
| Appearance: | White cryst. powder |
| Specification: | White cryst. powder Safety Statements:26-36-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 22:Do not breathe dust |
| HS Code: | 29252000 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | Deliquescent crystalline mass |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
