| Identification | |
| Name: | Piperazine,1-(2,4-dimethylphenyl)- |
| Synonyms: | Piperazine,1-(2,4-xylyl)- (7CI,8CI);1-(2,4-Xylyl)piperazine;4-(2,4-Dimethylphenyl)piperazine;N-(2,4-Dimethylphenyl)piperazine;N-(2,4-Xylyl)piperazine; |
| CAS: | 1013-76-9 |
| EINECS: | 213-797-7 |
| Molecular Formula: | C12H18N2 |
| Molecular Weight: | 190.28 |
| InChI: | InChI=1/C12H18N2/c1-10-3-4-12(11(2)9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 152.2°C |
| Boiling Point: | 333.1°Cat760mmHg |
| Density: | 0.999g/cm3 |
| Refractive index: | 1.553-1.555 |
| Appearance: | clear slightly colored liquid |
| Specification: |
1-(2,4-Xylyl)piperazine , with CAS number of 1013-76-9, can be called piperazine, 1-(2,4-dimethylphenyl)- ; 1-(2,4-Dimethylphenyl)piperazin ; 1-(2,4-xylyl)piperazine . It is a clear slightly colored liquid. |
| Flash Point: | 152.2°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
