| Identification | |
| Name: | 1-(3,4-Dimethylphenyl)piperazine |
| Synonyms: | - |
| CAS: | 1014-05-7 |
| EINECS: | 213-798-2 |
| Molecular Formula: | C12H18N2 |
| Molecular Weight: | 190.28 |
| InChI: | InChI=1/C12H18N2/c1-10-3-4-12(9-11(10)2)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3259 |
| Flash Point: | 156.6°C |
| Density: | 0.999g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | light beige to faintly yellow crystalline powder |
| Specification: |
2-(3,4-dimethylphenyl)piperidine , with CAS number of 1014-05-7, can be called 1-(3,4-xylyl)piperazine . It is a light beige to faintly yellow crystalline powder. |
| Packinggroup: | II |
| Flash Point: | 156.6°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
