| Identification | |
| Name: | 2-Propanol,1,1',1'',1'''-(1,2-ethanediyldinitrilo)tetrakis- |
| Synonyms: | 2-Propanol,1,1',1'',1'''-(ethylenedinitrilo)tetra- (6CI,7CI,8CI);1,1',1'',1'''-(1,2-Ethanediyldinitrilo)tetrakis[2-propanol];1,1',1'',1'''-(Ethylenedinitrilo)tetra(2-propanol);1,1',1'',1'''-(Ethylenedinitrilo)tetrakis(2-propanol);Adeka Quadrol;ENTPROL;EPD 300;Edetol;Laprol 294;N,N,N',N'-Tetra(2-hydroxypropyl)ethylenediamine;N,N,N',N'-Tetrakis(2-hydroxypropyl)ethylenediamine;N,N,N',N'-Tetrakis(b-hydroxypropyl)ethylenediamine;NP 300;NSC 369219;Neutrol;Neutrol TE;Newpol NP 300;Quadrol;Quadrol L;THPE;Tetrakis(2-hydroxypropyl)ethylenediamine; |
| CAS: | 102-60-3 |
| EINECS: | 203-041-4 |
| Molecular Formula: | C14H32N2O4 |
| Molecular Weight: | 292.41 |
| InChI: | InChI=1/C14H32N2O4/c1-11(17)7-15(8-12(2)18)5-6-16(9-13(3)19)10-14(4)20/h11-14,17-20H,5-10H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.013 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4795-1.4815 |
| Water Solubility: | miscible |
| Solubility: | Miscible. |
| Appearance: | clear, colorless - pale yellow |
| Specification: | clear colorless to pale yellow viscous liquid Safety Statements:36/37-37-24 36/37:Wear suitable protective clothing and gloves 37:Wear suitable gloves 24:Avoid contact with skin |
| HS Code: | 29221980 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | VISCOUS LIQUID WATER-WHITE LIQUID |
| Usage: | A cross-linking agent & catalyst in the manufacture of urethane foams, in epoxy resin curing, as complexing agent, as humectant, plasticizer. Sensitive coating on piezoelectric crystal detectors of so2. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
