| Identification |
| Name: | Acetamide,2-(diethylamino)-N-(2,4,6-trimethylphenyl)-, hydrochloride (1:1) |
| Synonyms: | Acetamide,2-(diethylamino)-N-(2,4,6-trimethylphenyl)-, monohydrochloride (9CI);Acetanilide, 2-(diethylamino)-2',4',6'-trimethyl-, monohydrochloride (8CI);Acetanilide, 2-diethylamino-2',4',6'-trimethyl-, hydrochloride (6CI); Mesocain;Mesocaine; Trimecaine hydrochloride; Trimekain hydrochloride |
| CAS: | 1027-14-1 |
| EINECS: | 213-836-8 |
| Molecular Formula: | C15H24 N2 O . Cl H |
| Molecular Weight: | 284.87 |
| InChI: | InChI=1/C15H24N2O.ClH/c1-6-17(7-2)10-14(18)16-15-12(4)8-11(3)9-13(15)5;/h8-9H,6-7,10H2,1-5H3,(H,16,18);1H |
| Molecular Structure: |
 |
| Properties |
| Specification: |
Trimecaine Monohydrochloride ,its cas register number is 1027-14-1. It also can be called Mesocaine ; Acetanilide, 2-(diethylamino)-2',4',6'-trimethyl-, hydrochloride ; and 2-(Diethylamino)-N-(2,4,6-trimethylphenyl)acetamide monohydrochloride .
|
| Safety Data |
| |
 |