| Identification | |
| Name: | Disulfide,bis(4-methylphenyl)- |
| Synonyms: | p-Tolyldisulfide (6CI,8CI);4-Methylphenyl disulfide;Biodylon;Bis(4-methylphenyl)disulfane;Bis(4-tolyl) disulfide;Bis(p-methylphenyl) disulfide;Bis(p-tolyl) disulfide;Di-4-tolyl disulfide;Di-p-Tolyl disulfide;Kresulfin;NSC 677466;NSC 994; |
| CAS: | 103-19-5 |
| EINECS: | 203-087-5 |
| Molecular Formula: | C14H14S2 |
| Molecular Weight: | 246.39 |
| InChI: | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3335 |
| Melting Point: | 43-46 °C(lit.) |
| Flash Point: | 192.6°C |
| Boiling Point: | 349.5°Cat760mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.649 |
| Appearance: | colorless to light yellow crystalline solid |
| Specification: | COLORLESS TO LIGHT YELLOW CRYSTALLINE SOLID Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 192.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
