Identification |
Name: | Disulfide,bis(4-methylphenyl)- |
Synonyms: | p-Tolyldisulfide (6CI,8CI);4-Methylphenyl disulfide;Biodylon;Bis(4-methylphenyl)disulfane;Bis(4-tolyl) disulfide;Bis(p-methylphenyl) disulfide;Bis(p-tolyl) disulfide;Di-4-tolyl disulfide;Di-p-Tolyl disulfide;Kresulfin;NSC 677466;NSC 994; |
CAS: | 103-19-5 |
EINECS: | 203-087-5 |
Molecular Formula: | C14H14S2 |
Molecular Weight: | 246.39 |
InChI: | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3335 |
Melting Point: | 43-46 °C(lit.)
|
Flash Point: | 192.6°C |
Boiling Point: | 349.5°Cat760mmHg |
Density: | 1.17g/cm3 |
Refractive index: | 1.649 |
Appearance: | colorless to light yellow crystalline solid |
Specification: | COLORLESS TO LIGHT YELLOW CRYSTALLINE SOLID Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 192.6°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|