| Identification | |
| Name: | Butanoic acid,3-methyl-, phenylmethyl ester |
| Synonyms: | Isovalericacid, benzyl ester (6CI,8CI); Benzyl 3-methylbutanoate; Benzyl3-methylbutyrate; Benzyl isopentanoate; Benzyl isovalerate; NSC 46124;Phenylmethyl isovalerate |
| CAS: | 103-38-8 |
| EINECS: | 203-106-7 |
| Molecular Formula: | C12H16O2 |
| Molecular Weight: | 192.25 |
| InChI: | InChI=1/C12H16O2/c1-10(2)8-12(13)14-9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 98.9°C |
| Boiling Point: | 245°Cat760mmHg |
| Density: | 1g/cm3 |
| Refractive index: | n20/D 1.488(lit.) |
| Specification: |
Benzyl isovalerate (CAS NO.103-38-8) is a colorless liquid, with floral, herbal aroma and like apples and blue cheese aroma. Soluble in ethanol and most of the non-volatile oil, slightly soluble in propylene glycol, glycerin and insoluble in water, can be used as edible spices, derived by the esterification of isovaleric acid and benzyl alcohol . Benzyl isovalerate (CAS NO.103-38-8) is a toxic material,be corrosive,burning will produce nitrogen oxides emitted toxic fumes.Besides should be stored and transported in low-temperature,drying environment. separately with oxidizing agents.Fire extinguishing agents water, carbon dioxide, dry powder, foam would be used if emergency. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 98.9°C |
| Safety Data | |
 |
|
