| Identification | |
| Name: | N-Acetylaniline |
| Synonyms: | Acetanilide; Antifebrin; Acetanilide,(N-Phenylacetamide); N-Phenylacetamide |
| CAS: | 103-84-4 |
| EINECS: | 203-150-7 |
| Molecular Formula: | C8H9NO |
| Molecular Weight: | 135.16 |
| InChI: | InChI=1/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.22 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, caustics, alkalies. |
| Refractive index: | 1.552 |
| Solubility: | Soluble in hot water |
| Appearance: | white leaflets or flakes |
| Specification: | grey or white powder or flakes Safety Statements:22-26-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29242995 |
| Storage Temperature: | Keep away from heat and flame. Store in a tightly closed container. Keep from contact with oxidizing materials. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep away from strong bases. |
| Color: | ORTHORHOMBIC PLATES OR SCALES FROM WATER WHITE SHINING CRYSTALLINE SCALES White, shining crystalline leaflets or white crystalline powder. Colorless, glossy, crystalline material. |
| Usage: | Manufacture of medicinals, dyes, stabilizer for hydrogen peroxide, as addn to cellulose ester varnishes. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
