| Identification |
| Name: | 4'-Bromoacetanilide |
| Synonyms: | N-(4-Bromophenyl)acetamide; 4-Bromoacetanilide; Bromoacetoanilide; 98%; 4-Bromoacetoanilide |
| CAS: | 103-88-8 |
| EINECS: | 203-154-9 |
| Molecular Formula: | C8H8BrNO |
| Molecular Weight: | 214.06 |
| InChI: | InChI=1/C8H8BrNO/c1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,1H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2811 |
| Density: | 1.543 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.611 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | Insoluble in water. Soluble in organic solvents. |
| Appearance: | white to light beige crystalline solid |
| Packinggroup: | III |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
