| Identification |
| Name: | 2-Amino-6-chloropurine |
| Synonyms: | 6-chloro-7H-purin-2-amine;6-chloro-5H-purin-2-amine;2-Amino-6-chlorpurine;1H-Purin-2-amine, 6-chloro-;6-Chloroguanine;1H-Purin-2-amine, 6-chloro- (9CI);Purine, 2-amino-6-chloro-;6-CHLORO-1H-PURIN-2-AMINE;6-Chloro-7H-purin-2-ylamine;6-Chloro-2-aminopurine;2-Amino-6-chloropurine(6-Chloroguanine);6-Chloro guanine 98%;2-Amino-6-chloropurine ( 6-Chloroguanine );2-Amino-6-chloro-9H-purine;6-chloro-9H-purin-2-amine;2-amino-6-chloro-purin; |
| CAS: | 10310-21-1 |
| EINECS: | 233-686-7 |
| Molecular Formula: | C5H4ClN5 |
| Molecular Weight: | 169.57 |
| InChI: | InChI=1/C5H4ClN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H3,7,8,9,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Density: | 2.09g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.826 |
| Solubility: | Soluble |
| Appearance: | white to off-white powder |
| Storage Temperature: | Keep Cold |
| Safety Data |
| Hazard Symbols |
|
| |
 |
