| Identification | |
| Name: | Potassium thioacetate |
| Synonyms: | Aceticacid, thio-, potassium salt (8CI);Ethanethioic acid, potassium salt (9CI);Potassium ethanethioate;Potassiumthioethanoate;S-Potassium thioacetate; |
| CAS: | 10387-40-3 |
| EINECS: | 233-848-7 |
| Molecular Formula: | C2H4KOS |
| Molecular Weight: | 114.2 |
| InChI: | InChI=1/C2H4OS.K/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.046g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | white crystal |
| Specification: |
?Potassium thioacetate , with CAS number of 10387-40-3, can be called Thioacetic acid potassium salt ; S-Potassium thioacetate ; Potassium thiolacetate ; Potassium thioethanoate ; Potassium thioacetate . It is a?white to light brown crystalline powder, used for synthesis of AIDS drugs etc. |
| Packinggroup: | II; III |
| HS Code: | 29309070 |
| Sensitive: | Air Sensitive & Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
